91467-48-0 Usage
Uses
Used in Pharmaceutical Development:
2-HYDRAZINO-5-NITRO-1H-1,3-BENZIMIDAZOLE is used as a precursor in the development of pharmaceuticals, leveraging its biological activities for medicinal chemistry research. Its potential applications in drug development are currently being explored, with ongoing research aiming to understand and harness its properties for the creation of novel therapeutic agents.
Used in Chemical Research:
In the realm of chemical research, 2-HYDRAZINO-5-NITRO-1H-1,3-BENZIMIDAZOLE serves as a subject of study for its unique chemical properties. Researchers are investigating its reactivity, stability, and how it can be modified or combined with other compounds to yield new chemical entities or products.
Used in Material Science:
Given its distinct structure, 2-HYDRAZINO-5-NITRO-1H-1,3-BENZIMIDAZOLE may also find applications in material science. Its potential use in the development of new materials with specific properties, such as those with enhanced stability or reactivity, is an area of ongoing investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 91467-48-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,4,6 and 7 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 91467-48:
(7*9)+(6*1)+(5*4)+(4*6)+(3*7)+(2*4)+(1*8)=150
150 % 10 = 0
So 91467-48-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N5O2/c8-11-7-9-5-2-1-4(12(13)14)3-6(5)10-7/h1-3H,8H2,(H2,9,10,11)
