91480-86-3 Usage
Molecular structure
A complex structure consisting of a pyrrole ring with a methyl group and a 3-methoxyphenyl group attached, as well as an amino and ketone group.
Potential applications
Pharmaceutical, agricultural, or industrial applications due to its potential for a variety of biological activities.
Further research needed
Specific properties and potential uses would need to be determined through additional research and testing.
Structural characteristics
The compound has an interesting combination of functional groups, which may contribute to its potential functional properties.
Biological activities
The compound may exhibit a range of biological activities, but these would need to be explored through further study.
Chemical classification
It is an organic compound, specifically a derivative of pyrrole, a heterocyclic compound.
Solubility
The solubility of the compound in various solvents would need to be determined, as this can impact its potential applications and methods of use.
Stability
The stability of the compound under different conditions (e.g., temperature, pH, light exposure) would need to be assessed to understand its suitability for various applications.
Synthesis
The method of synthesis for 1-[4-amino-5-(3-methoxyphenyl)-2-methyl-1H-pyrrol-3-yl]ethanone would be important to consider, as it can impact the cost, scalability, and environmental impact of producing the compound.
Safety and toxicity
The safety and potential toxicity of the compound would need to be evaluated, particularly if it is to be used in pharmaceutical or agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 91480-86-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,4,8 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 91480-86:
(7*9)+(6*1)+(5*4)+(4*8)+(3*0)+(2*8)+(1*6)=143
143 % 10 = 3
So 91480-86-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H16N2O2/c1-8-12(9(2)17)13(15)14(16-8)10-5-4-6-11(7-10)18-3/h4-7,16H,15H2,1-3H3
