914947-26-5 Usage
General Description
6-Bromo-2-pyridinemethanamine, hydrochloride is a chemical compound that consists of a pyridine ring with a bromine atom and an amine group attached to it. It is commonly used as an intermediate in the synthesis of various pharmaceuticals, agrochemicals, and organic compounds. 6-BROMO-2-PYRIDINEMETHANAMINE, HYDROCHLORIDE is also known for its antimicrobial and antifungal properties, making it useful in the development of new drugs and treatments. Additionally, it can be used as a building block in the production of various heterocyclic compounds and has the potential for application in organic synthesis and medicinal chemistry. Its hydrochloride salt form is water-soluble, making it easier to handle and administer in various chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 914947-26-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,4,9,4 and 7 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 914947-26:
(8*9)+(7*1)+(6*4)+(5*9)+(4*4)+(3*7)+(2*2)+(1*6)=195
195 % 10 = 5
So 914947-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BrN2.ClH/c7-6-3-1-2-5(4-8)9-6;/h1-3H,4,8H2;1H