915142-91-5 Usage
General Description
Ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate is a chemical compound with the molecular formula C9H8N2O2. It is a heterocyclic organic compound and a derivative of pyrrolopyrimidine. Ethyl 7H-pyrrolo[2,3-d]pyriMidine-4-carboxylate is commonly used as a building block in organic synthesis and pharmaceutical research. It possesses potential therapeutic properties and is being studied for its use in the development of new drugs. Ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate has applications in the field of medicinal chemistry and drug discovery due to its unique structure and potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 915142-91-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,5,1,4 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 915142-91:
(8*9)+(7*1)+(6*5)+(5*1)+(4*4)+(3*2)+(2*9)+(1*1)=155
155 % 10 = 5
So 915142-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O2/c1-2-14-9(13)7-6-3-4-10-8(6)12-5-11-7/h3-5H,2H2,1H3,(H,10,11,12)
