91560-85-9 Usage
Chemical structure
Contains a piperazine ring with a 3-bromobenzyl group and a methyl group attached to it.
Molecular weight
Approximately 256.15 g/mol
Functional groups
Piperazine ring, benzene ring, bromine atom, and methyl group
Appearance
Typically a solid or crystalline substance
Solubility
Soluble in organic solvents such as ethanol, methanol, and acetone
Synthesis
Often used as a building block in the creation of various pharmaceutical compounds
Applications
Used in the synthesis of drugs such as antipsychotics, antidepressants, and antihistamines
Biological activity
Presence of the bromobenzyl group can facilitate binding to specific biological receptors, leading to potential therapeutic effects
Reactivity
Can undergo reactions such as substitution, addition, and elimination due to the presence of the benzene ring and the piperazine ring
Stability
Generally stable under normal conditions, but sensitive to light, heat, and moisture
Safety
Handle with care, as it may have potential health risks and should be stored in a well-ventilated area, away from heat and flame sources
Regulatory status
May be subject to regulatory controls depending on the intended use and jurisdiction
Environmental impact
Potentially harmful to the environment, so proper disposal and handling procedures should be followed.
Check Digit Verification of cas no
The CAS Registry Mumber 91560-85-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,5,6 and 0 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 91560-85:
(7*9)+(6*1)+(5*5)+(4*6)+(3*0)+(2*8)+(1*5)=139
139 % 10 = 9
So 91560-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H17BrN2/c1-14-5-7-15(8-6-14)10-11-3-2-4-12(13)9-11/h2-4,9H,5-8,10H2,1H3
