91562-48-0 Usage
Uses
Used in Pharmaceutical Industry:
1-(5,6,7,8-TETRAHYDRONAPHTHALEN-2-YL)ETHANAMINE is used as a chemical intermediate for the development of new drug therapies. Its cyclic structure and amine group contribute to the creation of molecules with diverse biological properties, enhancing its potential in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical field, 1-(5,6,7,8-TETRAHYDRONAPHTHALEN-2-YL)ETHANAMINE is used as a precursor in the synthesis of various agrochemicals. Its reactivity allows for the development of compounds with applications in crop protection and pest control.
Used in Organic Chemistry Research:
1-(5,6,7,8-TETRAHYDRONAPHTHALEN-2-YL)ETHANAMINE is utilized as a versatile precursor in organic chemistry research. Its unique structure facilitates the exploration of new reaction pathways and the synthesis of novel organic compounds with potential applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 91562-48-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,5,6 and 2 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 91562-48:
(7*9)+(6*1)+(5*5)+(4*6)+(3*2)+(2*4)+(1*8)=140
140 % 10 = 0
So 91562-48-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H17N/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h6-9H,2-5,13H2,1H3/p+1/t9-/m1/s1
91562-48-0Relevant academic research and scientific papers
AMIDE COMPOUND AND METHOD OF CONTROLLING PLANT DISEASE WITH THE SAME
-
Page/Page column 107, (2010/02/14)
A amid compound of the formula (1): wherein, in the formula, R51 represents a halogen atom, a C1-C6 alkyl group and the like; R52 represents a hydrogen atom, a halogen atom, a C1-C6 alkyl group and the like; R53 represents a halogen atom and the like; R56 represents a halogen atom and the like; R57 represents a hydrogen atom and the like; R58 and R59 independently represent a hydrogen atom, a C1-C3 alkyl group and the like; R60 represents a C1-C4 alkyl group, a C1-C4 haloalkyl group, a C3-C4 alkenyl group, or a C3-C6 alkynyl group; R61 represents a C1-C4 alkyl group, a C1-C4 haloalkyl group, a C3-C4 alkenyl group or a C3-C6 alkynyl group or a C2-C4 cyanoalkyl group; R62, R63 and R64 represent a hydrogen atom, a halogen atom and the like; X represents a oxygen atom or a sulfur atom; has an excellent activity against plant diseases.