915707-58-3 Usage
Description
4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carboxylic acid is a heterocyclic chemical compound characterized by a pyrido-oxazine ring system and a carboxylic acid group. Its complex structure and unique features may offer potential pharmaceutical or research applications.
Used in Pharmaceutical Industry:
4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carboxylic acid is used as a starting material for the synthesis of other compounds due to its unique structural features and the presence of the carboxylic acid group, which can be utilized in drug design for various therapeutic purposes.
Used in Research Applications:
In the field of research, 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carboxylic acid serves as a valuable compound for studying its properties and potential uses, given its heterocyclic nature and the presence of the carboxylic acid group that may offer novel insights into chemical reactions and interactions.
Check Digit Verification of cas no
The CAS Registry Mumber 915707-58-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,5,7,0 and 7 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 915707-58:
(8*9)+(7*1)+(6*5)+(5*7)+(4*0)+(3*7)+(2*5)+(1*8)=183
183 % 10 = 3
So 915707-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O3/c1-11-2-3-14-7-4-6(9(12)13)5-10-8(7)11/h4-5H,2-3H2,1H3,(H,12,13)