91579-11-2 Usage
Uses
Used in Pharmaceutical Industry:
2-(Benzylamino)-1-(4-nitrophenyl)ethan-1-ol is used as a key intermediate in the synthesis of various pharmaceuticals for its unique reactivity and structural properties. It plays a crucial role in the development of new drugs and the improvement of existing ones.
Used in Organic Synthesis:
In the field of organic synthesis, 2-(Benzylamino)-1-(4-nitrophenyl)ethan-1-ol is utilized as a versatile building block for the creation of complex organic compounds. Its presence of a benzyl group, amino group, and nitrophenyl group allows for a wide range of chemical reactions, enabling the synthesis of diverse organic molecules with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 91579-11-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,5,7 and 9 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 91579-11:
(7*9)+(6*1)+(5*5)+(4*7)+(3*9)+(2*1)+(1*1)=152
152 % 10 = 2
So 91579-11-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2O3/c18-15(11-16-10-12-4-2-1-3-5-12)13-6-8-14(9-7-13)17(19)20/h1-9,15-16,18H,10-11H2
