915922-20-2 Usage
Uses
Used in Pharmaceutical Synthesis:
1-(2-BROMOETHOXY)-2-ETHYLBENZENE is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of a wide range of medicinal compounds, contributing to the development of new drugs and therapies.
Used in Agrochemical Production:
In the agrochemical industry, 1-(2-BROMOETHOXY)-2-ETHYLBENZENE is utilized as a starting material for the production of various agrochemicals. Its incorporation into these products helps improve their effectiveness in protecting crops and enhancing agricultural yields.
Used as an Industrial Solvent:
1-(2-BROMOETHOXY)-2-ETHYLBENZENE is also employed as a solvent in some industrial processes. Its properties make it suitable for dissolving specific substances, facilitating various chemical reactions and processes in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 915922-20-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,5,9,2 and 2 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 915922-20:
(8*9)+(7*1)+(6*5)+(5*9)+(4*2)+(3*2)+(2*2)+(1*0)=172
172 % 10 = 2
So 915922-20-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BrO/c1-2-9-5-3-4-6-10(9)12-8-7-11/h3-6H,2,7-8H2,1H3
