916572-56-0 Usage
Properties
1. Molecular Formula: \textC15\textH13\textN3
2. Heterocyclic Compound: Contains both a quinoline ring and a pyrrolidine ring.
3. Potential Biological Activity: Studied for its potential application in drug development.
4. Interest in Pharmaceutical Industry: Due to its unique structure and potential pharmaceutical properties.
Molecular Structure
Consists of a quinoline ring attached to a pyrrolidine ring.
Functional Groups
Contains nitrogen atoms in both rings, contributing to its heterocyclic nature.
Pharmaceutical Relevance
Investigated for potential use in drug development, indicating possible pharmacological effects.
Research Focus
Due to its potential biological activity and unique structure, it is a subject of interest for further research and development in the pharmaceutical field.
Check Digit Verification of cas no
The CAS Registry Mumber 916572-56-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,6,5,7 and 2 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 916572-56:
(8*9)+(7*1)+(6*6)+(5*5)+(4*7)+(3*2)+(2*5)+(1*6)=190
190 % 10 = 0
So 916572-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2/c1-2-5-12-10(4-1)8-11(9-15-12)13-6-3-7-14-13/h1-2,4-5,8-9H,3,6-7H2