916766-91-1 Usage
General Description
1-(Thieno[3,2-d]pyrimidin-4-yl)piperidine-4-carboxaldehyde is a chemical compound with the molecular formula C14H15N3OS. It is a piperidine-based compound containing a thieno[3,2-d]pyrimidine-4-yl group and a carboxaldehyde functional group. 1-(Thieno[3,2-d]pyrimidin-4-yl)piperidine-4-carboxaldehyde may have potential applications in pharmaceutical research and medicinal chemistry due to its unique structure and potential biological activities. The presence of the thieno[3,2-d]pyrimidine moiety suggests that this compound may exhibit interesting pharmacological properties, although further studies are needed to fully understand its potential uses and effects. In addition, the piperidine and carboxaldehyde groups also contribute to the compound's chemical reactivity and potential functionalization for various applications in drug discovery and development. Overall, 1-(Thieno[3,2-d]pyrimidin-4-yl)piperidine-4-carboxaldehyde is a compound of interest for researchers in the fields of medicinal chemistry and pharmaceutical science.
Check Digit Verification of cas no
The CAS Registry Mumber 916766-91-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,6,7,6 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 916766-91:
(8*9)+(7*1)+(6*6)+(5*7)+(4*6)+(3*6)+(2*9)+(1*1)=211
211 % 10 = 1
So 916766-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3OS/c16-7-9-1-4-15(5-2-9)12-11-10(3-6-17-11)13-8-14-12/h3,6-9H,1-2,4-5H2
