916766-99-9 Usage
General Description
3-{[(allyloxy)carbonyl]amino}-5-hydroxybenzoic acid is a chemical compound with the molecular formula C13H13NO5. It is a derivative of 5-hydroxybenzoic acid, with an allyloxy carbonyl amino group attached to the third carbon atom. 3-{[(allyloxy)carbonyl]amino}-5-hydroxybenzoic acid is often used in organic synthesis and pharmaceutical research due to its potential as a building block for drug molecules and bioactive compounds. Its structure contains a benzene ring with a hydroxyl group and an allyloxy carbonyl amino group, making it a versatile compound for various chemical reactions. It may also have potential applications in the development of new pharmaceuticals and bioactive molecules due to its unique structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 916766-99-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,6,7,6 and 6 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 916766-99:
(8*9)+(7*1)+(6*6)+(5*7)+(4*6)+(3*6)+(2*9)+(1*9)=219
219 % 10 = 9
So 916766-99-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO5/c1-2-3-17-11(16)12-8-4-7(10(14)15)5-9(13)6-8/h2,4-6,13H,1,3H2,(H,12,16)(H,14,15)
