916791-08-7 Usage
Uses
Used in Pharmaceutical Research:
1-(4-CHLORO-PYRIMIDIN-2-YL)-PIPERIDIN-4-OL is used as a building block for the synthesis of various drugs and biologically active compounds, contributing to the development of new therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(4-CHLORO-PYRIMIDIN-2-YL)-PIPERIDIN-4-OL serves as a versatile intermediate, enabling the creation of a wide range of chemical structures with potential applications in medicine and other industries.
Used in Medicinal Chemistry:
1-(4-CHLORO-PYRIMIDIN-2-YL)-PIPERIDIN-4-OL is utilized in medicinal chemistry for its potential pharmacological properties, allowing researchers to explore its interactions with biological systems in a specific and controlled manner, leading to the discovery of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 916791-08-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,6,7,9 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 916791-08:
(8*9)+(7*1)+(6*6)+(5*7)+(4*9)+(3*1)+(2*0)+(1*8)=197
197 % 10 = 7
So 916791-08-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12ClN3O/c10-8-1-4-11-9(12-8)13-5-2-7(14)3-6-13/h1,4,7,14H,2-3,5-6H2
