916792-07-9 Usage
Uses
Used in Pharmaceutical Industry:
2-BROMO-4-FLUORO-5-METHYLBENZONITRILE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and reactivity contribute to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-BROMO-4-FLUORO-5-METHYLBENZONITRILE serves as an intermediate in the production of agrochemicals, such as pesticides and herbicides, due to its ability to enhance the effectiveness and selectivity of these compounds.
Used in Dye and Pigment Manufacturing:
2-BROMO-4-FLUORO-5-METHYLBENZONITRILE is used as a building block in the manufacturing of dyes and pigments, where its unique chemical properties contribute to the creation of novel colorants with improved properties.
Used in Specialty Chemicals Production:
2-BROMO-4-FLUORO-5-METHYLBENZONITRILE is also utilized in the production of specialty chemicals, where its versatility in organic synthesis allows for the development of innovative products with specific applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 916792-07-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,6,7,9 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 916792-07:
(8*9)+(7*1)+(6*6)+(5*7)+(4*9)+(3*2)+(2*0)+(1*7)=199
199 % 10 = 9
So 916792-07-9 is a valid CAS Registry Number.
InChI:InChI=1S/C8H5BrFN/c1-5-2-6(4-11)7(9)3-8(5)10/h2-3H,1H3
