916792-08-0 Usage
Uses
Used in Pharmaceutical Industry:
2,3,5,6-Tetrafluoropyridine-4-propionic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties, contributing to advancements in medicine.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3,5,6-tetrafluoropyridine-4-propionic acid is utilized as a precursor for the production of agrochemicals. Its reactivity and functional groups enable the creation of compounds that can be used in the development of pesticides, herbicides, and other agricultural products to improve crop yields and protect against pests.
Used in Organic Synthesis:
2,3,5,6-Tetrafluoropyridine-4-propionic acid is used as a versatile building block in organic synthesis. Its fluorinated pyridine ring and propionic acid group facilitate the creation of a wide range of organic compounds for various applications, including the development of new materials and specialty chemicals.
Used in Drug Discovery and Development:
2,3,5,6-TETRAFLUOROPYRIDINE-4-PROPIONIC ACID is employed as a valuable tool in drug discovery and development. Its unique chemical properties and structure make it suitable for the design and synthesis of new drug candidates, potentially leading to the creation of innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 916792-08-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,6,7,9 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 916792-08:
(8*9)+(7*1)+(6*6)+(5*7)+(4*9)+(3*2)+(2*0)+(1*8)=200
200 % 10 = 0
So 916792-08-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H5F4NO2/c9-5-3(1-2-4(14)15)6(10)8(12)13-7(5)11/h1-2H2,(H,14,15)
