91828-95-4 Usage
Abbreviation
TMDC
Chemical structure
A tricarboxylic acid derivative containing a thiomorpholine ring
Pharmaceutical applications
Potential use in drug design and development
Anticancer properties
Studied for its potential as an anticancer agent
Antimicrobial properties
Investigated for its potential antimicrobial properties
Antioxidant properties
Has been studied for its potential antioxidant properties
Enzyme inhibition
Investigated for its ability to inhibit enzymes involved in cancer and other diseases
Diabetes treatment
Shown promise in the potential treatment of diabetes
Versatility
A versatile compound with potential for various pharmaceutical applications
Check Digit Verification of cas no
The CAS Registry Mumber 91828-95-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,8,2 and 8 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 91828-95:
(7*9)+(6*1)+(5*8)+(4*2)+(3*8)+(2*9)+(1*5)=164
164 % 10 = 4
So 91828-95-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H9NO4S/c8-5(9)3-1-12-2-4(7-3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11)
