91853-89-3 Usage
Description
Biotinyl-6-aminoquinoline is a chemical compound that combines the properties of biotin and 6-aminoquinoline. It is characterized by the presence of a biotin molecule linked to an aminoquinoline moiety, which allows for specific interactions and applications in various fields.
Uses
Used in Enzyme Activity Assays:
Biotinyl-6-aminoquinoline is used as a substrate for the determination of biotinidase activity. Biotinidase is an enzyme that plays a crucial role in the recycling of biotin, a vitamin essential for various cellular processes. By using Biotinyl-6-aminoquinoline as a substrate, researchers can accurately measure the activity of biotinidase, which can be helpful in diagnosing and monitoring certain metabolic disorders associated with biotinidase deficiency.
Check Digit Verification of cas no
The CAS Registry Mumber 91853-89-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,8,5 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 91853-89:
(7*9)+(6*1)+(5*8)+(4*5)+(3*3)+(2*8)+(1*9)=163
163 % 10 = 3
So 91853-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H22N4O2S/c24-17(21-13-7-8-14-12(10-13)4-3-9-20-14)6-2-1-5-16-18-15(11-26-16)22-19(25)23-18/h3-4,7-10,15-16,18H,1-2,5-6,11H2,(H,21,24)(H2,22,23,25)/t15-,16-,18-/m0/s1