91889-40-6

Usage

Uses

Used in Organic Synthesis:
rac-1-(4’-Methoxyphenyl)propanol-d2 is used as a synthetic intermediate for the preparation of a wide range of organic compounds. Its unique structure, featuring a 4’-methoxyphenyl group and a deuterated propanol moiety, allows it to be a versatile building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, rac-1-(4’-Methoxyphenyl)propanol-d2 is employed as a key component in the development of new drugs. Its incorporation into drug molecules can potentially enhance their stability, selectivity, and overall therapeutic efficacy. The deuterium labeling also provides an opportunity to study the metabolic pathways and pharmacokinetics of the resulting drug candidates.
Used in Chemical Research:
rac-1-(4’-Methoxyphenyl)propanol-d2 is utilized as a research tool in various chemical studies. Its deuterated nature allows researchers to investigate the effects of isotopic substitution on reaction mechanisms, kinetics, and product selectivity. This knowledge can be applied to optimize synthetic routes and improve the efficiency of chemical processes.
Used in Material Science:
In the field of material science, rac-1-(4’-Methoxyphenyl)propanol-d2 can be used as a component in the synthesis of novel materials with specific properties. Its incorporation into polymers, for instance, may lead to materials with improved thermal stability, mechanical strength, or other desirable characteristics.

InChI:InChI=1/C10H14O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7,10-11H,3H2,1-2H3/i3D2