91902-94-2 Usage
Uses
Used in Pharmaceutical Industry:
(2E)-3-(2-ETHYL-1-BENZOFURAN-3-YL)ACRYLIC ACID is used as a building block for the synthesis of various organic compounds, which can be further utilized in the development of pharmaceuticals. Its unique structure and properties make it a promising candidate for drug discovery and disease treatment.
Used in Materials Science:
(2E)-3-(2-ETHYL-1-BENZOFURAN-3-YL)ACRYLIC ACID is used as a component in the development of new materials with specific properties. Its unique structure allows it to be incorporated into various materials, potentially enhancing their performance and functionality.
Used in Research and Development:
(2E)-3-(2-ETHYL-1-BENZOFURAN-3-YL)ACRYLIC ACID is used as a research compound to study its biological activity and potential applications in drug development. Further studies are needed to fully understand its properties and explore its potential uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 91902-94-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,9,0 and 2 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 91902-94:
(7*9)+(6*1)+(5*9)+(4*0)+(3*2)+(2*9)+(1*4)=142
142 % 10 = 2
So 91902-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H12O3/c1-2-11-10(7-8-13(14)15)9-5-3-4-6-12(9)16-11/h3-8H,2H2,1H3,(H,14,15)/b8-7+
