91908-37-1 Usage
Uses
Used in Pharmaceutical Research:
(3,4-DIETHOXY-PHENYL)-ACETIC ACID HYDRAZIDE is used as a key intermediate in the synthesis of pharmaceutical compounds for various therapeutic applications. Its unique chemical structure allows for the development of novel drug candidates with potential therapeutic benefits.
Used in Organic Synthesis:
In the field of organic synthesis, (3,4-DIETHOXY-PHENYL)-ACETIC ACID HYDRAZIDE serves as a versatile building block for the creation of a wide range of organic molecules. Its reactivity and functional groups enable the formation of diverse chemical entities, contributing to the advancement of organic chemistry.
Used in Drug Development:
(3,4-DIETHOXY-PHENYL)-ACETIC ACID HYDRAZIDE is utilized in the development of new drugs, where its properties can be harnessed to design and optimize pharmaceutical agents with improved efficacy, safety, and pharmacokinetic profiles. Its potential applications in drug discovery make it a valuable asset in the pharmaceutical industry.
Used in Chemical Research:
In chemical research, (3,4-DIETHOXY-PHENYL)-ACETIC ACID HYDRAZIDE is employed as a model compound to study various chemical reactions and mechanisms. Its unique structure provides insights into the reactivity and selectivity of hydrazide derivatives, furthering the understanding of organic chemistry principles.
Used in Industrial Applications:
(3,4-DIETHOXY-PHENYL)-ACETIC ACID HYDRAZIDE may also find applications in various industrial processes, where its chemical properties can be exploited for the production of specialty chemicals, materials, or other products. Its versatility and potential uses in different industries highlight its importance in the broader chemical landscape.
Check Digit Verification of cas no
The CAS Registry Mumber 91908-37-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,9,0 and 8 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 91908-37:
(7*9)+(6*1)+(5*9)+(4*0)+(3*8)+(2*3)+(1*7)=151
151 % 10 = 1
So 91908-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H18N2O3/c1-3-16-10-6-5-9(8-12(15)14-13)7-11(10)17-4-2/h5-7H,3-4,8,13H2,1-2H3,(H,14,15)
