91981-59-8 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
1-[1,2,4]Triazolo[4,3-a]pyridin-3-ylmethanamine is utilized as a building block in the creation of new drugs due to its unique chemical structure. Its triazolo ring fused to a pyridine ring and the primary amine functional group at the 3-position contribute to its potential in developing therapeutic agents.
Used in the Treatment of Central Nervous System Disorders:
In the pharmaceutical industry, 1-[1,2,4]Triazolo[4,3-a]pyridin-3-ylmethanamine is employed as a precursor or intermediate in the synthesis of drugs targeting central nervous system disorders. Its specific chemical properties allow for the design of molecules that can interact with neurological receptors or pathways, potentially leading to the development of treatments for various neurological conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 91981-59-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,9,8 and 1 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 91981-59:
(7*9)+(6*1)+(5*9)+(4*8)+(3*1)+(2*5)+(1*9)=168
168 % 10 = 8
So 91981-59-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4/c8-5-7-10-9-6-3-1-2-4-11(6)7/h1-4H,5,8H2/p+1
