92062-57-2 Usage
Uses
Used in Pharmaceutical Industry:
Benzaldehyde,m-chloro-, oxime-d (7CI) is used as an intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a key component in the production of drugs with specific therapeutic properties.
Used in Fragrance Industry:
Benzaldehyde,m-chloro-, oxime-d (7CI) is used as a fragrance ingredient due to its distinct aromatic properties. It contributes to the creation of various scents in perfumes, colognes, and other fragrance products, enhancing their overall appeal and longevity.
Used in Flavoring Industry:
Benzaldehyde,m-chloro-, oxime-d (7CI) is employed as a flavoring agent in the food industry. Its unique taste profile adds depth and complexity to various food products, making it a valuable component in the development of flavors for confectionery, beverages, and other food items.
Used as a Reagent in Organic Synthesis:
In the field of organic chemistry, Benzaldehyde,m-chloro-, oxime-d (7CI) serves as a reagent in various synthesis processes. Its reactive nature allows it to participate in multiple chemical reactions, facilitating the production of desired compounds and contributing to the advancement of organic chemistry.
Safety Precautions:
It is important to handle Benzaldehyde,m-chloro-, oxime-d (7CI) with care, as it can cause irritation to the skin, eyes, and respiratory system. Proper safety measures, such as wearing protective gear and working in well-ventilated areas, should be taken to minimize potential health risks associated with Benzaldehyde,m-chloro-, oxime-d (7CI).
Check Digit Verification of cas no
The CAS Registry Mumber 92062-57-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,0,6 and 2 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 92062-57:
(7*9)+(6*2)+(5*0)+(4*6)+(3*2)+(2*5)+(1*7)=122
122 % 10 = 2
So 92062-57-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H6ClNO/c8-7-3-1-2-6(4-7)5-9-10/h1-5,10H
