92075-69-9 Usage
Uses
Used in Pharmaceutical Synthesis:
1,2,3,4-Tetrahydro-1,4-methanonaphthalene-2,3-dicarboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its carboxylic acid groups allow for the formation of new chemical compounds, contributing to the development of novel drugs.
Used in Organic Material Synthesis:
In the field of organic materials, 1,2,3,4-tetrahydro-1,4-methanonaphthalene-2,3-dicarboxylic acid is used as a building block for the creation of new organic compounds. Its unique structure and functional groups enable the design and synthesis of advanced materials with specific properties.
Used in Drug Development:
1,2,3,4-Tetrahydro-1,4-methanonaphthalene-2,3-dicarboxylic acid is used as a potential therapeutic agent in drug development. Research suggests that it may possess therapeutic properties, making it a valuable compound for further investigation in medicinal chemistry and the development of new treatments.
Used in Medicinal Chemistry Research:
In medicinal chemistry, 1,2,3,4-tetrahydro-1,4-methanonaphthalene-2,3-dicarboxylic acid is used as a subject of study to explore its potential applications and properties. Its unique structure and functional groups make it an interesting compound for understanding its interactions with biological systems and its potential as a therapeutic agent.
Check Digit Verification of cas no
The CAS Registry Mumber 92075-69-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,0,7 and 5 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 92075-69:
(7*9)+(6*2)+(5*0)+(4*7)+(3*5)+(2*6)+(1*9)=139
139 % 10 = 9
So 92075-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H12O4/c14-12(15)10-8-5-9(11(10)13(16)17)7-4-2-1-3-6(7)8/h1-4,8-11H,5H2,(H,14,15)(H,16,17)
92075-69-9Relevant academic research and scientific papers
Antiviral 1,2,3,4-tetrahydro-1,-alkano naphthalenamine derivatives
-
, (2008/06/13)
Amine derivatives of 1,2,3,4-tetrahydro-1,4-alkanonaphthalenes, and the use of such compounds to control viral infections, particularly influenza viruses, in warm-blooded animals are disclosed. Pharmaceutical compositions containing an effective amount of the novel compounds and a pharmaceutically acceptable carrier are also disclosed.
