921753-34-6 Usage
General Description
3,3-Difluorocyclohexanamine is a chemical compound with the molecular formula C6H11F2N. It is an amine, meaning it contains a nitrogen atom with a lone pair of electrons, and it also has two fluorine atoms attached to the cyclohexane ring. 3,3-Difluorocyclohexanamine is used in organic synthesis as a building block for other chemicals. It can also be used as a reagent in the production of pharmaceuticals and agrochemicals. Additionally, 3,3-Difluorocyclohexanamine has potential applications in the field of medicinal chemistry due to its ability to bind to biological targets and potentially exhibit biological activity. Overall, this compound has diverse industrial and research applications due to its unique structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 921753-34-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,1,7,5 and 3 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 921753-34:
(8*9)+(7*2)+(6*1)+(5*7)+(4*5)+(3*3)+(2*3)+(1*4)=166
166 % 10 = 6
So 921753-34-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H11F2N/c7-6(8)3-1-2-5(9)4-6/h5H,1-4,9H2
