921753-37-9 Usage
Uses
Used in Pharmaceutical Industry:
2,2-difluorocyclohexanamine is used as an intermediate in the synthesis of various pharmaceutical compounds for its unique reactivity and properties. The presence of fluorine atoms can enhance the stability and bioavailability of the final drug products.
Used in Chemical Synthesis:
2,2-difluorocyclohexanamine is used as a building block in the synthesis of more complex organic molecules, particularly in the field of materials science. The fluorine atoms can impart specific chemical and physical properties to the resulting compounds, making them suitable for various applications.
Used in Research and Development:
2,2-difluorocyclohexanamine is used as a research compound in academic and industrial laboratories to study the effects of fluorination on the chemical properties and reactivity of amines. This can lead to the discovery of new reactions and applications for fluorinated compounds.
Note: The specific uses and potential risks of 2,2-difluorocyclohexanamine are not widely documented, suggesting it may be a specialty or less-commonly used chemical. However, the general applications mentioned above are based on the properties of fluorinated secondary amines and their typical uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 921753-37-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,1,7,5 and 3 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 921753-37:
(8*9)+(7*2)+(6*1)+(5*7)+(4*5)+(3*3)+(2*3)+(1*7)=169
169 % 10 = 9
So 921753-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H11F2N/c7-6(8)4-2-1-3-5(6)9/h5H,1-4,9H2
