921938-54-7 Usage
Uses
Used in Pharmaceutical Industry:
3-(4-Isocyanatophenyl)-1-methyl-1H-pyrazole is used as a pharmaceutical intermediate for the development of new drugs. Its pyrazole core and isocyanate group provide a foundation for the synthesis of compounds with potential anti-inflammatory and antiviral properties, making it a valuable component in medicinal chemistry.
Used in Material Science:
In the field of material science, 3-(4-Isocyanatophenyl)-1-methyl-1H-pyrazole is used as a reactive building block for the creation of novel materials. 3-(4-Isocyanatophenyl)-1-methyl-1H-pyrazole's ability to form urethane linkages can be leveraged to develop materials with specific properties, such as polyurethane foams and coatings, which have applications in various industries including construction, automotive, and textiles.
Used in Chemical Synthesis:
3-(4-Isocyanatophenyl)-1-methyl-1H-pyrazole serves as a versatile intermediate in organic synthesis. Its reactivity allows for the formation of a wide range of chemical products, making it a useful compound for the synthesis of complex organic molecules and potential new pharmaceutical agents.
Overall, 3-(4-Isocyanatophenyl)-1-methyl-1H-pyrazole is a multifaceted compound with applications in various industries, including pharmaceuticals, material science, and chemical synthesis, due to its unique structural features and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 921938-54-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,1,9,3 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 921938-54:
(8*9)+(7*2)+(6*1)+(5*9)+(4*3)+(3*8)+(2*5)+(1*4)=187
187 % 10 = 7
So 921938-54-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H9N3O/c1-14-7-6-11(13-14)9-2-4-10(5-3-9)12-8-15/h2-7H,1H3
