921938-80-9 Usage
Uses
Used in Organic Synthesis:
4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carboxaldehyde is used as a key intermediate in organic synthesis for the preparation of various complex organic molecules. Its unique structure and functional groups allow for versatile chemical reactions, making it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carboxaldehyde is used as a starting material for the development of new drugs. Its aldehyde and carboxyl groups can be modified to create a wide range of bioactive compounds with potential therapeutic applications. Researchers leverage its reactivity to design and synthesize novel drug candidates with improved pharmacological properties.
Used in Material Science:
4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carboxaldehyde may also find applications in material science, where its unique structure and properties can be utilized to develop new materials with specific characteristics. For instance, it could be used in the synthesis of polymers, coatings, or other materials with tailored properties for various applications.
Used in Agrochemicals:
In the agrochemical industry, 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carboxaldehyde can be employed as a precursor for the synthesis of novel agrochemicals, such as pesticides or plant growth regulators. Its potential reactivity and structural features make it a promising candidate for the development of new and more effective agrochemical products.
Due to the complex nature and potential reactivity of 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carboxaldehyde, it is essential to handle and store 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carboxaldehyde with care to prevent unwanted reactions or decomposition. This ensures the safety and effectiveness of its applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 921938-80-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,1,9,3 and 8 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 921938-80:
(8*9)+(7*2)+(6*1)+(5*9)+(4*3)+(3*8)+(2*8)+(1*0)=189
189 % 10 = 9
So 921938-80-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O2/c1-11-2-3-13-8-4-7(6-12)5-10-9(8)11/h4-6H,2-3H2,1H3
