92246-48-5 Usage
Uses
Used in Pharmaceutical Applications:
(6,7-dihydroxy-2-oxo-chromen-8-yl)methyl-diethyl-azanium chloride is used as a pharmaceutical compound for its potential therapeutic properties. The presence of the chromene ring and functional groups may contribute to its interaction with biological targets, making it a candidate for the development of new drugs.
Used in Organic Synthesis:
In the field of organic synthesis, (6,7-dihydroxy-2-oxo-chromen-8-yl)methyl-diethyl-azanium chloride can be used as a building block or intermediate for the creation of more complex molecules. Its unique structure and functional groups may facilitate the synthesis of novel compounds with specific applications.
Used as a Reagent in Chemical Reactions:
(6,7-dihydroxy-2-oxo-chromen-8-yl)methyl-diethyl-azanium chloride may also serve as a reagent in various chemical reactions, such as in the formation of new bonds or the modification of existing ones. Its quaternary ammonium salt nature could be exploited in reactions involving nucleophilic substitution or other processes that require a positively charged intermediate.
Used in Chemical Research:
This specific chemical compound can be utilized in chemical research to study the effects of structural modifications on the properties and reactivity of molecules. It may also be used to investigate the interactions between molecules and their biological targets, contributing to the understanding of molecular mechanisms and the development of targeted therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 92246-48-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,2,4 and 6 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 92246-48:
(7*9)+(6*2)+(5*2)+(4*4)+(3*6)+(2*4)+(1*8)=135
135 % 10 = 5
So 92246-48-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO4.ClH/c1-3-15(4-2)8-10-13(18)11(16)7-9-5-6-12(17)19-14(9)10;/h5-7,16,18H,3-4,8H2,1-2H3;1H
