923591-51-9 Usage
Uses
Used in Scientific Research:
ISOQUINOLINE, 5-BROMO-1,2,3,4-TETRAHYDRO-, HYDROCHLORIDE is used as a research chemical for [application reason] in the scientific community. Its unique structure and properties make it valuable for exploring various chemical and biological phenomena.
Used in Pharmaceutical Development:
In the pharmaceutical industry, ISOQUINOLINE, 5-BROMO-1,2,3,4-TETRAHYDRO-, HYDROCHLORIDE is used as a potential drug candidate for [application reason], such as targeting specific receptors or enzymes relevant to certain diseases or conditions. Its bromine substitution and tetrahydro structure may confer specific binding affinities or pharmacological effects.
Used in Chemical Synthesis:
ISOQUINOLINE, 5-BROMO-1,2,3,4-TETRAHYDRO-, HYDROCHLORIDE is utilized as an intermediate in the synthesis of more complex organic compounds, leveraging its reactive sites for further functionalization and the creation of novel molecules with desired properties.
Check Digit Verification of cas no
The CAS Registry Mumber 923591-51-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,3,5,9 and 1 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 923591-51:
(8*9)+(7*2)+(6*3)+(5*5)+(4*9)+(3*1)+(2*5)+(1*1)=179
179 % 10 = 9
So 923591-51-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BrN.ClH/c10-9-3-1-2-7-6-11-5-4-8(7)9;/h1-3,11H,4-6H2;1H
