924304-73-4 Usage
Uses
Used in Pharmaceutical Research and Development:
1-BOC-PYRROLIDINE-3-CARBOXYLIC ACID is used as a building block for the synthesis of various pharmaceuticals and biologically active molecules. Its versatile structure allows for the modification and functionalization of the proline moiety, making it a valuable tool in drug discovery and development.
Used in Organic Synthesis:
1-BOC-PYRROLIDINE-3-CARBOXYLIC ACID is used as a key intermediate in the synthesis of complex organic compounds, taking advantage of its unique structure and reactivity.
Used as a Chiral Auxiliary in Asymmetric Synthesis:
1-BOC-PYRROLIDINE-3-CARBOXYLIC ACID is used as a chiral auxiliary in asymmetric synthesis to control the stereochemistry of reactions, leading to the formation of enantiomerically pure products.
Used in Catalysis:
1-BOC-PYRROLIDINE-3-CARBOXYLIC ACID is employed as a chiral catalyst in various chemical reactions, enhancing the selectivity and efficiency of the processes.
Used in Peptide Chemistry:
1-BOC-PYRROLIDINE-3-CARBOXYLIC ACID is used in peptide chemistry for the synthesis of peptides and peptidomimetics, taking advantage of its unique properties and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 924304-73-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,4,3,0 and 4 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 924304-73:
(8*9)+(7*2)+(6*4)+(5*3)+(4*0)+(3*4)+(2*7)+(1*3)=154
154 % 10 = 4
So 924304-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClN.ClH/c9-8-3-1-2-6-4-10-5-7(6)8;/h1-3,10H,4-5H2;1H
