92513-39-8 Usage
Description
6-Bromo-2-methylquinoline-3-carboxylic acid is a chemical compound with the molecular formula C12H9BrN2O2. It is a derivative of quinoline and contains a carboxylic acid group. 6-BROMO-2-METHYLQUINOLINE-3-CARBOXYLIC ACID is recognized for its role as a key intermediate in the synthesis of various pharmaceuticals and drug candidates, particularly those with potential anticancer and antimicrobial properties.
Uses
Used in Pharmaceutical Industry:
6-Bromo-2-methylquinoline-3-carboxylic acid is used as a building block for the synthesis of various pharmaceuticals and drug candidates. Its unique structure and functional groups make it a valuable component in the development of new medications with potential applications in treating a range of diseases.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 6-Bromo-2-methylquinoline-3-carboxylic acid is utilized as a key intermediate for the preparation of biologically active molecules. Its presence in these molecules can contribute to their therapeutic effects, making it an essential part of drug discovery and development processes.
Used in Drug Discovery:
6-Bromo-2-methylquinoline-3-carboxylic acid is also researched for its potential applications in drug discovery. Its ability to be incorporated into various molecular structures allows for the exploration of its properties and how it may contribute to the creation of novel and effective drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 92513-39-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,5,1 and 3 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 92513-39:
(7*9)+(6*2)+(5*5)+(4*1)+(3*3)+(2*3)+(1*9)=128
128 % 10 = 8
So 92513-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H8BrNO2/c1-6-9(11(14)15)5-7-4-8(12)2-3-10(7)13-6/h2-5H,1H3,(H,14,15)
