925211-08-1 Usage
Uses
Used in Organic Synthesis:
2,3-Dioxoindoline-7-carbonitrile is used as a key intermediate in the synthesis of various biologically active molecules. Its unique structure allows for the creation of a wide range of compounds with potential applications in different fields.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2,3-Dioxoindoline-7-carbonitrile is utilized as a starting material for the development of new drugs and pharmaceuticals. Its potential pharmacological properties, such as enzyme inhibition and cancer treatment, make it a promising candidate for further research and development.
Used in Cancer Treatment Research:
2,3-Dioxoindoline-7-carbonitrile has been studied for its potential use in cancer treatment. Its ability to inhibit certain enzymes may contribute to the development of novel therapeutic agents targeting cancer cells, offering new treatment options for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 925211-08-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,5,2,1 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 925211-08:
(8*9)+(7*2)+(6*5)+(5*2)+(4*1)+(3*1)+(2*0)+(1*8)=141
141 % 10 = 1
So 925211-08-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H4N2O2/c10-4-5-2-1-3-6-7(5)11-9(13)8(6)12/h1-3H,(H,11,12,13)
