92555-01-6 Usage
Structure
Complex chemical structure containing a thiazolidin-4-one ring, which is a five-membered heterocyclic compound with sulfur and nitrogen atoms.
Biological Properties
Has potential pharmacological activities, including anti-inflammatory, antimicrobial, and anticancer properties.
Molecular Structure
Contains functional groups that make it a valuable building block for the synthesis of various pharmaceuticals and bioactive compounds.
Research
Further research is being conducted to explore its potential medical applications and to better understand its chemical and biological properties.
Applications
Potential use in the development of new pharmaceuticals and bioactive compounds due to its unique structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 92555-01-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,5,5 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 92555-01:
(7*9)+(6*2)+(5*5)+(4*5)+(3*5)+(2*0)+(1*1)=136
136 % 10 = 6
So 92555-01-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H13N3O2S2/c1-9-11(8-12-13(19)16-15(21)22-12)14(20)18(17(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,16,19,21)
