926191-91-5 Usage
Explanation
A diazepane derivative is a compound that contains a diazepane ring, which is a six-membered ring with four carbon atoms and two nitrogen atoms.
3. 1-(methoxyacetyl) group
Explanation
This group consists of a methoxy (CH3O-) and an acetyl group (CH3CO) attached to the first carbon atom of the diazepane ring.
4. Potential pharmaceutical applications
Explanation
Due to its structural features and functional groups, 1-(methoxyacetyl)-1,4-diazepane may have potential uses in the pharmaceutical industry. However, further research and testing are required to determine its specific applications and properties.
5. Structural features
Explanation
The compound's structure includes a six-membered diazepane ring with a methoxyacetyl group attached to the first carbon atom, which may contribute to its potential pharmaceutical applications.
6. Functional groups
Explanation
The presence of a methoxy and an acetyl group in the molecule provides functional groups that can interact with biological targets, potentially leading to pharmaceutical applications.
7. Further research and testing needed
Explanation
To fully understand the properties and potential uses of 1-(methoxyacetyl)-1,4-diazepane, additional research and testing are necessary to explore its interactions with biological systems and its efficacy in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 926191-91-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,6,1,9 and 1 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 926191-91:
(8*9)+(7*2)+(6*6)+(5*1)+(4*9)+(3*1)+(2*9)+(1*1)=185
185 % 10 = 5
So 926191-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2O2/c1-12-7-8(11)10-5-2-3-9-4-6-10/h9H,2-7H2,1H3
