92658-77-0 Usage
Uses
Used in Pharmaceutical Industry:
1-[1-(5-METHYLISOXAZOL-3-YL)-1H-1,2,4-TRIAZOL-3-YL]ACETONE is used as a potential antifungal and antibacterial agent due to the presence of the triazolone ring, which is known for its biological activities.
Used in Agricultural Industry:
1-[1-(5-METHYLISOXAZOL-3-YL)-1H-1,2,4-TRIAZOL-3-YL]ACETONE is used as a potential pesticide or fungicide, leveraging its antifungal and antibacterial properties to protect crops from diseases and pests.
Used in Materials Science:
1-[1-(5-METHYLISOXAZOL-3-YL)-1H-1,2,4-TRIAZOL-3-YL]ACETONE is used in the development of new materials with unique properties, such as antimicrobial coatings or self-healing materials, due to its potential biological activities and chemical structure.
Check Digit Verification of cas no
The CAS Registry Mumber 92658-77-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,6,5 and 8 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 92658-77:
(7*9)+(6*2)+(5*6)+(4*5)+(3*8)+(2*7)+(1*7)=170
170 % 10 = 0
So 92658-77-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N4O2/c1-6(14)3-8-10-5-13(11-8)9-4-7(2)15-12-9/h4-5H,3H2,1-2H3
