92687-89-3 Usage
Molecular structure
A complex structure with a pentacyclic ring system and a total of eleven carbon atoms.
Chemical composition
Contains a chlorine atom and a methylene group.
Classification
Belongs to the class of organic compounds known as steroids and derivatives.
Origin
A synthetic derivative of the naturally occurring steroid hormone testosterone.
Applications
Potential applications in the field of medicinal chemistry and drug development.
Biological properties
May exhibit interesting biological properties due to its unique structure.
Pharmacological properties
May exhibit interesting pharmacological properties due to its unique structure.
Research interest
A subject of interest for further research and exploration in the field of chemistry and medicine.
Functional groups
Contains a carbonyl group (C=O) at the 8th position of the pentacyclic ring system.
Stereochemistry
The compound may have multiple stereoisomers due to the presence of chiral centers in the pentacyclic ring system.
Solubility
The solubility of the compound in different solvents may vary depending on its specific stereochemistry and functional groups.
Stability
The stability of the compound under different conditions (e.g., temperature, pH, light exposure) may be influenced by its molecular structure and functional groups.
Synthesis
The synthesis of 11-Chloromethylene pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one may involve multiple steps and require specific reagents and reaction conditions.
Analytical techniques
Techniques such as nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry, and infrared (IR) spectroscopy may be used to analyze and characterize the compound.
Check Digit Verification of cas no
The CAS Registry Mumber 92687-89-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,6,8 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 92687-89:
(7*9)+(6*2)+(5*6)+(4*8)+(3*7)+(2*8)+(1*9)=183
183 % 10 = 3
So 92687-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H11ClO/c13-2-5-6-3-1-4-8-7(3)9(5)11(8)12(14)10(4)6/h2-4,6-11H,1H2/b5-2+
