926921-64-4 Usage
Description
Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate is a chemical compound with the molecular formula C11H5F5N2O2. It is an ester derivative of pyrazole, containing a pentafluorophenyl group and a methyl group attached to the pyrazole ring. This versatile and valuable chemical is widely used in various fields of science and industry.
Uses
Used in Organic Synthesis:
Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate is used as a building block in organic synthesis for the preparation of pharmaceuticals, agrochemicals, and other biologically active compounds. Its unique structure and properties make it a valuable component in the development of new and effective molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate is used as a key intermediate in the synthesis of various drug candidates. Its presence in the molecular structure can impart specific biological activities and improve the pharmacokinetic properties of the final drug product.
Used in Agrochemical Industry:
Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate is also utilized in the agrochemical industry for the development of new pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness and selectivity, leading to improved crop protection.
Used in Material Science:
Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate has been studied for its potential use in the development of new materials. Its unique properties, such as its reactivity and stability, make it a promising candidate for creating innovative materials with specific applications in various industries.
Used as a Reagent in Chemical Reactions:
In addition to its applications in synthesis and material development, pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate is also used as a reagent in various chemical reactions. Its ability to participate in a wide range of reactions makes it a valuable tool for chemists in their research and development efforts.
Check Digit Verification of cas no
The CAS Registry Mumber 926921-64-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,6,9,2 and 1 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 926921-64:
(8*9)+(7*2)+(6*6)+(5*9)+(4*2)+(3*1)+(2*6)+(1*4)=194
194 % 10 = 4
So 926921-64-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H5F5N2O2/c1-18-4(2-3-17-18)11(19)20-10-8(15)6(13)5(12)7(14)9(10)16/h2-3H,1H3
