927800-62-2 Usage
Uses
Used in Pharmaceutical Research and Development:
4-BROMO-8-METHOXY-2-METHYLQUINOLINE is used as a building block in the synthesis of various compounds for pharmaceutical applications. Its unique structure and properties make it a promising candidate for the development of new drugs and pharmaceutical products.
Used in Medicinal Chemistry:
4-BROMO-8-METHOXY-2-METHYLQUINOLINE is used as a key intermediate in the synthesis of bioactive molecules for medicinal chemistry research. The presence of a bromine atom and a methoxy group in the molecule allows for further functionalization and modification, enabling the exploration of its potential in various medicinal and biological studies.
Used in Chemical Synthesis:
4-BROMO-8-METHOXY-2-METHYLQUINOLINE is used as a versatile starting material in chemical synthesis, particularly in the preparation of quinoline-based compounds. Its unique structure and reactivity make it suitable for various synthetic routes and transformations, contributing to the discovery of novel chemical entities.
Used in Biological Studies:
4-BROMO-8-METHOXY-2-METHYLQUINOLINE is used as a research tool in biological studies to investigate its potential biological activities and interactions with biological targets. Its unique structure and properties make it an interesting candidate for exploring its effects on various biological processes and pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 927800-62-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,7,8,0 and 0 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 927800-62:
(8*9)+(7*2)+(6*7)+(5*8)+(4*0)+(3*0)+(2*6)+(1*2)=182
182 % 10 = 2
So 927800-62-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10BrNO/c1-7-6-9(12)8-4-3-5-10(14-2)11(8)13-7/h3-6H,1-2H3
927800-62-2Relevant academic research and scientific papers
8-OXY-QUINOLINE DERIVATIVES AS BRADYKININ B2 RECEPTOR MODULATORS
-
Page/Page column 124, (2008/12/04)
The present invention is related to compound of the formula (I): or a pharmacologically acceptable salt, solvate, or hydrate thereof, wherein A is a 6-membered heteroaryl having from 1 to 3 heteroatoms, each independently selected from N or O and the other substituents are defined as in the claims.
