927801-09-0 Usage
Uses
Used in Medicinal Chemistry:
3-Bromo-7-chloro-4-(piperazin-1-yl)quinoline is used as a chemical intermediate for the development of new drugs due to its unique structure and properties.
Used in Antimicrobial Applications:
In the pharmaceutical industry, 3-Bromo-7-chloro-4-(piperazin-1-yl)quinoline is used as an antimicrobial agent for its ability to inhibit the growth and reproduction of certain microorganisms.
Used in Antiparasitic Applications:
3-Bromo-7-chloro-4-(piperazin-1-yl)quinoline is used as an antiparasitic agent, leveraging its capacity to curb the proliferation of specific parasites.
Used in Anti-cancer Applications:
3-Bromo-7-chloro-4-(piperazin-1-yl)quinoline is used as a potential anti-cancer agent, being investigated for its possible role in combating cancer cells.
Overall, the chemical structure of 3-Bromo-7-chloro-4-(piperazin-1-yl)quinoline makes it a versatile compound with potential applications in various fields of research, particularly in the development of pharmaceuticals for infectious diseases and cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 927801-09-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,7,8,0 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 927801-09:
(8*9)+(7*2)+(6*7)+(5*8)+(4*0)+(3*1)+(2*0)+(1*9)=180
180 % 10 = 0
So 927801-09-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H13BrClN3/c14-11-8-17-12-7-9(15)1-2-10(12)13(11)18-5-3-16-4-6-18/h1-2,7-8,16H,3-6H2