927870-76-6 Usage
Uses
Used in Scientific Research:
2-Hydroxy-5-iodo-6-methylpyridine is used as a chemical intermediate for the synthesis of various compounds in scientific research. Its unique structure allows for the development of new molecules with potential applications in different fields.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2-Hydroxy-5-iodo-6-methylpyridine is used as a building block for the creation of new drug candidates. Its structural properties make it a valuable component in the design of novel therapeutic agents.
Used in Chemical Synthesis:
2-Hydroxy-5-iodo-6-methylpyridine is employed as a reagent in the synthesis of complex organic molecules. Its presence in the reaction mixture can lead to the formation of new compounds with diverse applications in various industries.
Used in Material Science:
In the field of material science, 2-Hydroxy-5-iodo-6-methylpyridine is used as a component in the development of new materials with specific properties. Its incorporation into the material's structure can result in enhanced characteristics, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 927870-76-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,7,8,7 and 0 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 927870-76:
(8*9)+(7*2)+(6*7)+(5*8)+(4*7)+(3*0)+(2*7)+(1*6)=216
216 % 10 = 6
So 927870-76-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6INO/c1-4-5(7)2-3-6(9)8-4/h2-3H,1H3,(H,8,9)
