927870-76-6 Usage
General Description
2-Hydroxy-5-iodo-6-methylpyridine is a chemical compound recognized by its unique structural formula. Its molecular formula is C6H6INO, indicating that it comprises six carbon atoms, six hydrogen atoms, one iodine atom, and one nitrogen atom. This chemical compound falls under the class of pyridines, organic compounds characterized by a six-membered aromatic ring with one nitrogen atom. While specific physical and chemical properties, such as melting point, boiling point, density, and solubility may be variable or inadequately documented, its synthesis and usage are primarily observed within scientific research environments. Its potential risks or hazards, both environmental and health-related, have not been specifically documented, thus warranting safe and proper handling.
Check Digit Verification of cas no
The CAS Registry Mumber 927870-76-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,7,8,7 and 0 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 927870-76:
(8*9)+(7*2)+(6*7)+(5*8)+(4*7)+(3*0)+(2*7)+(1*6)=216
216 % 10 = 6
So 927870-76-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6INO/c1-4-5(7)2-3-6(9)8-4/h2-3H,1H3,(H,8,9)