92961-04-1 Usage
Uses
Used in Fluorescent Dye Production:
2,7-dichloro-4-nitro-9H-fluorene serves as a key component in the production of fluorescent dyes. It is utilized as a starting material for synthesizing dyes that exhibit luminescent properties, which are crucial for applications in various industries.
Used in Pharmaceutical Intermediates:
In the pharmaceutical industry, 2,7-dichloro-4-nitro-9H-fluorene is employed as an intermediate in the synthesis of various drugs. Its unique structure allows it to be a building block for creating complex organic molecules with therapeutic potential.
Used in Organic Compound Synthesis:
2,7-dichloro-4-nitro-9H-fluorene is also used as a building block for the synthesis of other organic compounds. Its versatility in chemical reactions makes it a valuable asset in the development of new materials and substances with specific properties.
Used in Research and Development:
2,7-dichloro-4-nitro-9H-fluorene is utilized in research and development settings due to its unique properties. Scientists and researchers leverage its characteristics to explore new avenues in chemical synthesis and to understand its behavior in various chemical environments.
Check Digit Verification of cas no
The CAS Registry Mumber 92961-04-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,9,6 and 1 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 92961-04:
(7*9)+(6*2)+(5*9)+(4*6)+(3*1)+(2*0)+(1*4)=151
151 % 10 = 1
So 92961-04-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H7Cl2NO2/c14-9-1-2-11-7(4-9)3-8-5-10(15)6-12(13(8)11)16(17)18/h1-2,4-6H,3H2