92998-54-4 Usage
Uses
Used in Pharmaceutical Industry:
2-[[2-[(2-amino-3-methyl-butanoyl)amino]-3-methyl-butanoyl]amino]-3-methyl-butanoic acid is used as a potential drug candidate for various biochemical processes. Its complex structure and functional groups enable it to engage in specific interactions with biological systems, making it a promising candidate for the development of new pharmaceuticals.
The specific applications and reasons for the use of 2-[[2-[(2-amino-3-methyl-butanoyl)amino]-3-methyl-butanoyl]amino]-3-methyl-butanoic acid in the pharmaceutical industry are not provided in the materials. However, given the presence of amine and carboxylic acid groups, it can be inferred that 2-[[2-[(2-amino-3-methyl-butanoyl)amino]-3-methyl-butanoyl]amino]-3-methyl-butanoic acid may be involved in the modulation of biological processes, such as enzyme inhibition, receptor binding, or other interactions that could lead to therapeutic effects. Further research and development would be necessary to explore and validate its potential uses in drug discovery and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 92998-54-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,9,9 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 92998-54:
(7*9)+(6*2)+(5*9)+(4*9)+(3*8)+(2*5)+(1*4)=194
194 % 10 = 4
So 92998-54-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H29N3O4/c1-7(2)10(16)13(19)17-11(8(3)4)14(20)18-12(9(5)6)15(21)22/h7-12H,16H2,1-6H3,(H,17,19)(H,18,20)(H,21,22)
