93145-55-2 Usage
General Description
The chemical 2-[2-(azepan-1-yl)ethoxy]-1-phenyl-ethanol, also known as azepane, is a compound with a molecular formula C20H33NO2. It is a synthetic organic compound with a structure that includes a six-membered ring containing a nitrogen atom, a phenyl group, and an alcohol group. Azepane is commonly used as a building block in the synthesis of various pharmaceuticals and organic compounds due to its potential for creating diverse functional groups. It may also possess certain pharmacological properties, although further research is needed to fully understand its potential applications. Additionally, its structure and properties make it a potentially useful molecule in the fields of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 93145-55-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,1,4 and 5 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 93145-55:
(7*9)+(6*3)+(5*1)+(4*4)+(3*5)+(2*5)+(1*5)=132
132 % 10 = 2
So 93145-55-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H25NO2/c18-16(15-8-4-3-5-9-15)14-19-13-12-17-10-6-1-2-7-11-17/h3-5,8-9,16,18H,1-2,6-7,10-14H2
