932702-13-1 Usage
Uses
Used in Pharmaceutical Industry:
1H-Pyrazolo[3,4-c]pyridine-3-carboxylic acid is used as a chemical scaffold for the development of new drugs due to its potential pharmacological properties and versatile chemical structure that can be modified to target specific biological pathways.
Used in Medicinal Chemistry Research:
1H-Pyrazolo[3,4-c]pyridine-3-carboxylic acid serves as a key component in medicinal chemistry research, where it is utilized to explore and create innovative therapeutic agents that can address various medical conditions.
While the provided materials do not specify particular applications or industries for 1H-Pyrazolo[3,4-c]pyridine-3-carboxylic acid beyond its use in the pharmaceutical industry and medicinal chemistry research, its potential uses could be extrapolated based on its properties. For instance, it might be employed in the development of drugs targeting specific diseases or conditions, or in the creation of prodrugs that are activated in the body to produce the active pharmaceutical ingredient. However, without additional context or data, these uses remain speculative.
Check Digit Verification of cas no
The CAS Registry Mumber 932702-13-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,2,7,0 and 2 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 932702-13:
(8*9)+(7*3)+(6*2)+(5*7)+(4*0)+(3*2)+(2*1)+(1*3)=151
151 % 10 = 1
So 932702-13-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O2/c11-7(12)6-4-1-2-8-3-5(4)9-10-6/h1-3H,(H,9,10)(H,11,12)
932702-13-1Relevant articles and documents
Indazoles, benzothiazoles, benzoisothiazoles, benzisoxazoles, pyrazolopyridines, isothiazolopyridines, and preparation and uses thereof
-
Page/Page column 70, (2010/11/26)
The present invention relates generally to the field of ligands for nicotinic acetylcholine receptors (nACh receptors), activation of nACh receptors, and the treatment of disease conditions associated with defective or malfunctioning nicotinic acetylcholine receptors, especially of the brain. Further, this invention relates to novel compounds (e.g., indazoles and benzothiazoles), which act as ligands for the α7 nACh receptor subtype, methods of preparing such compounds, compositions containing such compounds, and methods of use thereof.
