93277-96-4 Usage
Description
Altapizone is a chemical intermediate that plays a crucial role in the synthesis of various bioactive compounds, including 6-Aryl-4,5-dihydro-3(2H)-pyridazinone and its derivatives. It is a versatile molecule with potential applications in the pharmaceutical industry due to its ability to form complex structures with other molecules.
Uses
Used in Pharmaceutical Industry:
Altapizone is used as a key intermediate in the preparation of bioactive compounds for various therapeutic applications. Its unique chemical properties allow it to form stable complexes with other molecules, making it an essential component in the development of new drugs.
Altapizone is used as a building block for the synthesis of 6-Aryl-4,5-dihydro-3(2H)-pyridazinone and other related compounds, which have potential applications in the treatment of various diseases and conditions. Its ability to form stable complexes with other molecules makes it a valuable asset in the development of new pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 93277-96-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,2,7 and 7 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 93277-96:
(7*9)+(6*3)+(5*2)+(4*7)+(3*7)+(2*9)+(1*6)=164
164 % 10 = 4
So 93277-96-4 is a valid CAS Registry Number.
InChI:InChI=1/C23H26N4O2/c28-22-11-10-21(25-26-22)18-6-8-19(9-7-18)24-23(29)16-17-12-14-27(15-13-17)20-4-2-1-3-5-20/h1-9,17H,10-16H2,(H,24,29)(H,26,28)
93277-96-4Relevant articles and documents
6-(acylaminoaryl)-3(2H)-pyridazinone derivatives and their use
-
, (2008/06/13)
Novel 6-(acylaminoaryl)-3(2H)-pyridazinones of the formula STR1 where R1, R2, R3, R4, A and B have the meanings given in the description, and their preparation are described and inhibiting thrombocyte aggregation and gastric secretion. The compounds are useful for treating disorders.