933696-71-0 Usage
Uses
Used in Pharmaceutical Industry:
6-Quinazolinemethanamine is used as a building block for the synthesis of various bioactive compounds due to its versatile chemical structure and potential in drug discovery and development.
Used in Anticancer Applications:
6-Quinazolinemethanamine is used as an anticancer agent for its potential effects on cell growth and apoptosis. It has been studied for its ability to target and inhibit the growth of cancer cells, making it a promising candidate for cancer treatment.
Used in Neurological Applications:
In the field of neurology, 6-Quinazolinemethanamine is used as a potential treatment for neurological disorders. It has been investigated for its role in modulating neurotransmitter systems in the brain, which could lead to the development of therapies for various neurological conditions.
Used in Anti-inflammatory Applications:
6-Quinazolinemethanamine is used as an anti-inflammatory agent due to its potential to modulate inflammatory responses. Its anti-inflammatory properties could be harnessed in the development of treatments for inflammatory diseases.
Used in Antimicrobial Applications:
In the field of microbiology, 6-Quinazolinemethanamine is used as an antimicrobial agent. Its potential to combat microbial infections makes it a valuable compound in the development of new antibiotics and antifungal agents.
Check Digit Verification of cas no
The CAS Registry Mumber 933696-71-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,3,6,9 and 6 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 933696-71:
(8*9)+(7*3)+(6*3)+(5*6)+(4*9)+(3*6)+(2*7)+(1*1)=210
210 % 10 = 0
So 933696-71-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3/c10-4-7-1-2-9-8(3-7)5-11-6-12-9/h1-3,5-6H,4,10H2
