933744-08-2 Usage
Uses
Used in Pharmaceutical Industry:
3-(1H-indazol-1-yl)propan-1-amine is used as a building block for the synthesis of various biologically active molecules. Its specific chemical structure and properties make it a valuable component in drug discovery and development processes.
Used in Drug Development:
3-(1H-indazol-1-yl)propan-1-amine is utilized as a key intermediate in the creation of potential drugs. Its presence in these molecules can contribute to their biological activity, making it an essential component in the advancement of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 933744-08-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,3,7,4 and 4 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 933744-08:
(8*9)+(7*3)+(6*3)+(5*7)+(4*4)+(3*4)+(2*0)+(1*8)=182
182 % 10 = 2
So 933744-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3/c11-6-3-7-13-10-5-2-1-4-9(10)8-12-13/h1-2,4-5,8H,3,6-7,11H2
