933752-32-0 Usage
Uses
Used in Pharmaceutical Industry:
1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid is used as a building block for the synthesis of various pharmaceutical compounds due to its unique chemical structure and bioactive properties. Its ability to interact with biological systems makes it a promising candidate for the development of new drugs or therapeutic agents.
Used in Medicinal Chemistry Research:
1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid is used as a subject of study in medicinal chemistry to explore its potential applications in drug development. Its chemical properties and interactions with biological systems can provide valuable insights into the design and synthesis of novel therapeutic agents.
Used in Organic Chemistry:
1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid is used in organic chemistry for the synthesis of various organic compounds. Its unique structure and reactivity make it a valuable component in the development of new organic compounds with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 933752-32-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,3,7,5 and 2 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 933752-32:
(8*9)+(7*3)+(6*3)+(5*7)+(4*5)+(3*2)+(2*3)+(1*2)=180
180 % 10 = 0
So 933752-32-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2/c12-10(13)8-1-2-9-6-11-4-3-7(9)5-8/h1-2,5,11H,3-4,6H2,(H,12,13)
