933752-44-4 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-1,3-thiazole-2-carboxaldehyde is used as a key intermediate for the synthesis of various pharmaceuticals, leveraging its reactivity and structural features to create compounds with potent biological activities. Its presence in the synthesis process is crucial for developing new drugs with improved therapeutic effects and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Bromo-1,3-thiazole-2-carboxaldehyde is utilized as a precursor in the development of new pesticides and other agrochemicals. Its ability to form stable and effective compounds makes it an essential component in creating products that protect crops and enhance agricultural productivity.
Used in Antimicrobial Agents:
5-Bromo-1,3-thiazole-2-carboxaldehyde is employed as a building block in the creation of antimicrobial agents, where its unique structure contributes to the development of compounds capable of combating resistant bacteria and other pathogens.
Used in Antiviral Compounds:
5-Bromo-1,3-thiazole-2-carboxaldehyde is also used in the synthesis of antiviral compounds, where its electrophilic properties aid in the design of molecules that can effectively inhibit viral replication and reduce the spread of viral diseases.
Used in Anticancer Drug Development:
5-Bromo-1,3-thiazole-2-carboxaldehyde plays a significant role in the development of anticancer drugs, where its reactivity and structural attributes are harnessed to synthesize molecules with the potential to target and eliminate cancer cells while minimizing damage to healthy cells.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 5-Bromo-1,3-thiazole-2-carboxaldehyde is used as a valuable tool for the exploration of new synthetic methods and the design of innovative drug candidates, contributing to the advancement of drug discovery and development processes.
Check Digit Verification of cas no
The CAS Registry Mumber 933752-44-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,3,7,5 and 2 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 933752-44:
(8*9)+(7*3)+(6*3)+(5*7)+(4*5)+(3*2)+(2*4)+(1*4)=184
184 % 10 = 4
So 933752-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H2BrNOS/c5-3-1-6-4(2-7)8-3/h1-2H
