933754-48-4 Usage
Uses
Used in Organic Synthesis:
2-(5-(pyridin-3-yl)-1,3,4-oxadiazol-2-yl)ethanamine is used as a building block in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for the formation of new chemical entities with potential applications in different fields.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-(5-(pyridin-3-yl)-1,3,4-oxadiazol-2-yl)ethanamine is used as a starting material or intermediate in the development of new drugs and medications. Its structure suggests that it may possess biological activity, which can be harnessed to target specific biological pathways or receptors, leading to the discovery of novel therapeutic agents.
Used in Drug Development:
2-(5-(pyridin-3-yl)-1,3,4-oxadiazol-2-yl)ethanamine is used as a potential active pharmaceutical ingredient (API) in drug development. Its unique chemical structure may offer new opportunities for the treatment of various diseases and conditions, pending further research into its pharmacological properties and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 933754-48-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,3,7,5 and 4 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 933754-48:
(8*9)+(7*3)+(6*3)+(5*7)+(4*5)+(3*4)+(2*4)+(1*8)=194
194 % 10 = 4
So 933754-48-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N4O/c10-4-3-8-12-13-9(14-8)7-2-1-5-11-6-7/h1-2,5-6H,3-4,10H2
